CymitQuimica logo

CAS 108046-27-1

:

4H-Cyclopenta[b]thiophen-4-amine, 5,6-dihydro-, hydrochloride (1:1)

Description:
4H-Cyclopenta[b]thiophen-4-amine, 5,6-dihydro-, hydrochloride (1:1) is a chemical compound characterized by its unique bicyclic structure, which incorporates a thiophene ring fused to a cyclopentane moiety. This compound features an amine functional group, contributing to its potential reactivity and interaction with biological systems. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The presence of the amine group suggests potential for hydrogen bonding and interaction with various receptors or enzymes. Its molecular structure may impart specific pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 4H-Cyclopenta[b]thiophen-4-amine, 5,6-dihydro-, hydrochloride is a compound with notable characteristics that warrant further investigation for its potential applications in drug development and other chemical processes.
Formula:C7H9NS·ClH
InChI:InChI=1S/C7H9NS.ClH/c8-6-1-2-7-5(6)3-4-9-7;/h3-4,6H,1-2,8H2;1H
InChI key:InChIKey=GOBKSXRMDWEKMG-UHFFFAOYSA-N
SMILES:NC1C2=C(SC=C2)CC1.Cl
Synonyms:
  • 4H-Cyclopenta[b]thiophen-4-amine, 5,6-dihydro-, hydrochloride (1:1)
  • 4H-Cyclopenta[b]thiophen-4-amine, 5,6-dihydro-, hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.