CAS 108051-21-4
:(2E)-1-(2,4-dihydroxyphenyl)-3-(2-methoxyphenyl)prop-2-en-1-one
Description:
The chemical substance known as (2E)-1-(2,4-dihydroxyphenyl)-3-(2-methoxyphenyl)prop-2-en-1-one, with the CAS number 108051-21-4, is a type of chalcone, which is characterized by its structure featuring a central α,β-unsaturated carbonyl group flanked by two aromatic rings. This compound exhibits notable antioxidant and anti-inflammatory properties, making it of interest in medicinal chemistry and pharmacology. The presence of hydroxyl groups on the aromatic ring enhances its reactivity and potential biological activity, while the methoxy group contributes to its lipophilicity and solubility in organic solvents. The compound may also exhibit various biological activities, including potential anticancer effects, due to its ability to modulate cellular pathways. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, this substance represents a significant area of study for its potential therapeutic applications and its role in the development of new pharmaceuticals.
Formula:C16H14O4
InChI:InChI=1/C16H14O4/c1-20-16-5-3-2-4-11(16)6-9-14(18)13-8-7-12(17)10-15(13)19/h2-10,17,19H,1H3/b9-6+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.