CAS 108051-94-1
:[(1S)-1-[[(2S,3S)-3-hexyl-4-oxo-oxetan-2-yl]methyl]dodecyl] (2S)-2-(benzyloxycarbonylamino)-4-methyl-pentanoate
Description:
The chemical substance with the name "[(1S)-1-[[(2S,3S)-3-hexyl-4-oxo-oxetan-2-yl]methyl]dodecyl] (2S)-2-(benzyloxycarbonylamino)-4-methyl-pentanoate" and CAS number "108051-94-1" is a complex organic compound characterized by its multi-functional structure. It features a long aliphatic chain, which contributes to its hydrophobic properties, alongside a cyclic oxetan moiety that introduces unique steric and electronic characteristics. The presence of a benzyloxycarbonylamino group indicates potential for interactions in biological systems, suggesting applications in pharmaceuticals or biochemistry. The stereochemistry, denoted by the (S) configurations, implies specific spatial arrangements that can influence the compound's reactivity and interactions with biological targets. Overall, this compound exemplifies the intricate design often found in synthetic organic chemistry, where specific functional groups and stereochemistry are tailored for desired properties and activities. Its complexity may also suggest challenges in synthesis and characterization, making it a subject of interest in advanced chemical research.
Formula:C36H59NO6
InChI:InChI=1/C36H59NO6/c1-5-7-9-11-12-13-14-15-19-23-30(26-33-31(34(38)43-33)24-20-10-8-6-2)42-35(39)32(25-28(3)4)37-36(40)41-27-29-21-17-16-18-22-29/h16-18,21-22,28,30-33H,5-15,19-20,23-27H2,1-4H3,(H,37,40)/t30-,31-,32-,33-/m0/s1
SMILES:CCCCCCCCCCC[C@@H](C[C@H]1[C@H](CCCCCC)C(=O)O1)OC(=O)[C@H](CC(C)C)N=C(O)OCc1ccccc1
Synonyms:- N-[(PhenylMethoxy)carbonyl]-L-Leucine (1S)-1-[[(2S,3S)-3-Hexyl-4
- L-Leucine, N-[(phenylmethoxy)carbonyl]-, (1S)-1-[[(2S,3S)-3-hexyl-4-oxo-2-oxetanyl]methyl]dodecyl ester
- -oxo-2-oxetanyl]Methyl]dodecyl Ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-Deformyl-N-benzyloxycarbonyl Orlistat
CAS:Controlled ProductFormula:C36H59NO6Color and Shape:NeatMolecular weight:601.857
