CAS 1080650-25-4

N-(3-Chloro-2-pyrazinyl)glycine

Description:

N-(3-Chloro-2-pyrazinyl)glycine is a chemical compound characterized by its unique structure, which includes a pyrazine ring substituted with a chlorine atom and an amino acid moiety, glycine. This compound typically exhibits properties associated with both heterocyclic compounds and amino acids, such as potential solubility in polar solvents due to the presence of the amino group. The chlorine substitution on the pyrazine ring can influence its reactivity and biological activity, potentially enhancing its interaction with specific biological targets. N-(3-Chloro-2-pyrazinyl)glycine may be of interest in pharmaceutical research, particularly in the development of new therapeutic agents, due to its structural features that could confer specific pharmacological properties. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, and its stability and reactivity would be influenced by the electronic effects of the chlorine atom and the overall molecular conformation. As with many compounds, safety data and handling precautions should be considered when working with this substance in a laboratory setting.

Formula: C₆H₆ClN₃O₂

InChI: InChI=1S/C6H6ClN3O2/c7-5-6(9-2-1-8-5)10-3-4(11)12/h1-2H,3H2,(H,9,10)(H,11,12)

InChI key: InChIKey=KOWIAQOGRCJWBY-UHFFFAOYSA-N

SMILES: N(CC(O)=O)C=1C(Cl)=NC=CN1

Synonyms:

• Glycine, N-(3-chloro-2-pyrazinyl)-
• 2-[(3-Chloropyrazin-2-yl)amino]acetic acid
• N-(3-Chloro-2-pyrazinyl)glycine