CAS 108073-61-6
:glucopiericidin B
Description:
Glucopiericidin B is a chemical compound classified as a natural product, specifically a type of alkaloid. It is derived from certain microbial sources, particularly from the fermentation of specific strains of bacteria. This compound is characterized by its complex molecular structure, which includes multiple functional groups that contribute to its biological activity. Glucopiericidin B has garnered interest in the field of medicinal chemistry due to its potential pharmacological properties, including antimicrobial and antitumor activities. Its mechanism of action may involve interactions with cellular pathways, although detailed studies are necessary to fully elucidate its effects. The compound is typically studied in the context of drug discovery and development, particularly for its potential therapeutic applications. As with many natural products, the extraction and purification processes can be challenging, and ongoing research aims to optimize these methods while exploring the compound's full range of biological activities.
Formula:C31H47NO9
InChI:InChI=1/C31H47NO9/c1-9-19(4)24(34)20(5)15-18(3)12-10-11-17(2)13-14-22-21(6)28(29(38-7)30(32-22)39-8)41-31-27(37)26(36)25(35)23(16-33)40-31/h9-10,12-13,15,20,23-27,31,33-37H,11,14,16H2,1-8H3/b12-10+,17-13+,18-15+,19-9+
Synonyms:- D-Glucopyranoside, 2-(10-hydroxy-3,7,9,11-tetramethyl-2,5,7,11,tridecatetraenyl)-5,6-dimethoxy-3-methyl-4-pyridinyl-, (R-(R*,R*(all E)))-
- glucopiericidin B
- 2-[(2E,5E,7E,11E)-10-hydroxy-3,7,9,11-tetramethyltrideca-2,5,7,11-tetraen-1-yl]-5,6-dimethoxy-3-methylpyridin-4-yl hexopyranoside
- Glucopiericidin B
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Glucopiericidin B
CAS:Glucopiericidin B exhibits antibacterial activity.Formula:C31H47NO9Color and Shape:SolidMolecular weight:577.706
