CAS 108086-37-9

2-CHLORO-N-(2-CHLORO-5-NITROPHENYL)ACETAMIDE

Description:

2-Chloro-N-(2-chloro-5-nitrophenyl)acetamide is an organic compound characterized by its structural features, which include a chloro group and a nitrophenyl moiety. This compound belongs to the class of acetamides and is notable for its potential applications in pharmaceuticals and agrochemicals. The presence of the nitro group contributes to its reactivity and may influence its biological activity. Typically, compounds like this exhibit moderate to high solubility in organic solvents, while their solubility in water can vary depending on the specific substituents and their interactions. The chloro substituents can enhance the compound's electrophilic character, making it useful in various chemical reactions. Additionally, the compound may exhibit specific biological activities, which could be of interest in medicinal chemistry. Safety data sheets would provide essential information regarding its handling, toxicity, and environmental impact, which are crucial for laboratory and industrial applications. Overall, 2-chloro-N-(2-chloro-5-nitrophenyl)acetamide is a compound of interest due to its unique chemical structure and potential utility in various fields.

Formula: C₈H₆Cl₂N₂O₃

InChI: InChI=1/C8H6Cl2N2O3/c9-4-8(13)11-7-3-5(12(14)15)1-2-6(7)10/h1-3H,4H2,(H,11,13)

SMILES: c1cc(c(cc1N(=O)=O)N=C(CCl)O)Cl

Synonyms:

• acetamide, 2-chloro-N-(2-chloro-5-nitrophenyl)-