CAS 108087-84-9
:N-(4-Ethoxyphenyl)maleamic acid
Description:
N-(4-Ethoxyphenyl)maleamic acid is an organic compound characterized by its maleamic acid structure, which features a maleic acid derivative with an ethoxyphenyl substituent. This compound typically exhibits properties associated with both amines and carboxylic acids, including the ability to form hydrogen bonds due to the presence of the amine and carboxylic acid functional groups. It is likely to be a solid at room temperature, with potential applications in organic synthesis, pharmaceuticals, or as an intermediate in the production of dyes and polymers. The ethoxy group contributes to its hydrophobic characteristics, while the maleamic acid moiety can participate in various chemical reactions, such as cycloaddition or polymerization. The compound's solubility may vary depending on the solvent, influenced by the balance between its polar and non-polar regions. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C12H13NO4
InChI:InChI=1/C12H13NO4/c1-2-17-10-5-3-9(4-6-10)13-11(14)7-8-12(15)16/h3-8H,2H2,1H3,(H,13,14)(H,15,16)/b8-7-
SMILES:CCOc1ccc(cc1)NC(=O)/C=C\C(=O)O
Synonyms:- (2Z)-4-[(4-ethoxyphenyl)amino]-4-oxobut-2-enoate
- (2Z)-4-[(4-ethoxyphenyl)amino]-4-oxobut-2-enoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
