CymitQuimica logo

CAS 108088-20-6

:

3,4-Dihydro-8-hydroxy-2H-1-benzopyran-3-carboxylic acid

Description:
3,4-Dihydro-8-hydroxy-2H-1-benzopyran-3-carboxylic acid, also known by its CAS number 108088-20-6, is a chemical compound characterized by its benzopyran structure, which features a fused benzene and pyran ring. This compound typically exhibits properties associated with phenolic compounds, including potential antioxidant activity due to the presence of the hydroxyl group. The carboxylic acid functional group contributes to its acidity and solubility in polar solvents. It may also participate in various chemical reactions, such as esterification and amidation, due to its reactive functional groups. The compound's structural features suggest potential applications in pharmaceuticals, particularly in the development of drugs targeting oxidative stress-related conditions. Additionally, its unique molecular configuration may influence its biological activity, making it a subject of interest in medicinal chemistry and natural product research. Overall, 3,4-Dihydro-8-hydroxy-2H-1-benzopyran-3-carboxylic acid represents a versatile compound with significant implications in various scientific fields.
Formula:C10H10O4
InChI:InChI=1S/C10H10O4/c11-8-3-1-2-6-4-7(10(12)13)5-14-9(6)8/h1-3,7,11H,4-5H2,(H,12,13)
InChI key:InChIKey=CETFDGHUCMLXAT-UHFFFAOYSA-N
SMILES:OC1=C2C(CC(C(O)=O)CO2)=CC=C1
Synonyms:
  • 3,4-Dihydro-8-hydroxy-2H-1-benzopyran-3-carboxylic acid
  • 2H-1-Benzopyran-3-carboxylic acid, 3,4-dihydro-8-hydroxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.