CAS 108097-04-7: 2-CHLORO-3,8-DIMETHYLQUINOLINE
Description:2-Chloro-3,8-dimethylquinoline is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of chlorine and two methyl groups at specific positions on the quinoline ring influences its chemical properties and reactivity. This compound typically exhibits a pale yellow to brownish color and is likely to be a solid at room temperature. It is soluble in organic solvents but may have limited solubility in water due to its hydrophobic nature. The chlorine atom introduces a polar functional group, which can enhance its reactivity in substitution reactions. Additionally, the methyl groups can affect the compound's steric hindrance and electronic properties, potentially influencing its biological activity and interactions with other molecules. 2-Chloro-3,8-dimethylquinoline may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential applications in drug development and as a chemical intermediate. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C11H10ClN
InChI:InChI=1/C11H10ClN/c1-7-4-3-5-9-6-8(2)11(12)13-10(7)9/h3-6H,1-2H3
- Synonyms:
- Quinoline, 2-Chloro-3,8-Dimethyl-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-Chloro-3,8-dimethylquinoline REF: 54-OR307903CAS: 108097-04-7 | - - - | 327.00 €~728.00 € | Wed 09 Apr 25 |
![]() | 2-Chloro-3,8-dimethylquinoline REF: 10-F765772CAS: 108097-04-7 | 98% | - - - | Discontinued product |
![]() | 2-Chloro-3,8-dimethylquinoline REF: 3D-IEA09704CAS: 108097-04-7 | Min. 95% | - - - | Discontinued product |

Ref: 10-F765772
1g | Discontinued | Request information | |
5g | Discontinued | Request information |

2-Chloro-3,8-dimethylquinoline
Ref: 3D-IEA09704
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information | |
2500mg | Discontinued | Request information |