CAS 108099-42-9

1-OXIDE-4-THIOMORPHOLINE ETHANOL

Description:

1-Oxide-4-thiomorpholine ethanol, identified by its CAS number 108099-42-9, is a chemical compound that features a morpholine ring with a sulfur atom and an alcohol functional group. This compound is characterized by its heterocyclic structure, which includes both nitrogen and sulfur atoms, contributing to its unique chemical properties. The presence of the thiomorpholine moiety imparts specific reactivity, particularly in nucleophilic substitution reactions. Additionally, the hydroxyl group in the ethanol portion enhances its solubility in polar solvents and may influence its interaction with biological systems. This compound may exhibit properties such as moderate stability under standard conditions, potential for forming hydrogen bonds due to the hydroxyl group, and possible applications in pharmaceuticals or as a chemical intermediate. However, detailed information regarding its toxicity, environmental impact, and specific applications would require further investigation and should be approached with caution in laboratory settings.

Formula: C₆H₁₃NO₂S

InChI: InChI=1/C6H13NO2S/c8-4-1-7-2-5-10(9)6-3-7/h8H,1-6H2

SMILES: C(CO)N1CCS(=O)CC1

Synonyms:

• N-(2-Hydroxyethyl) Thiomorpholine-1-Oxide
• 2-(1-Oxo-1,4-Thiazinan-4-Yl)Ethanol