CAS 1081-34-1
:2,2′:5′,2′′-Terthiophene
Description:
2,2′:5′,2′′-Terthiophene is an organic compound belonging to the class of thiophenes, which are five-membered aromatic heterocycles containing sulfur. This compound consists of three thiophene rings linked together, contributing to its unique electronic and optical properties. It is characterized by its yellow to orange color and exhibits good solubility in organic solvents. Terthiophene is known for its semiconducting properties, making it of interest in organic electronics, particularly in organic photovoltaic cells and field-effect transistors. The compound has a relatively high thermal stability and can undergo various chemical modifications, allowing for the tuning of its electronic properties. Additionally, terthiophene can participate in polymerization reactions, leading to the formation of conductive polymers. Its ability to form π-stacking interactions enhances its potential applications in materials science. Overall, 2,2′:5′,2′′-Terthiophene is a significant compound in the field of organic chemistry and materials science due to its versatile properties and applications.
Formula:C12H8S3
InChI:InChI=1S/C12H8S3/c1-3-9(13-7-1)11-5-6-12(15-11)10-4-2-8-14-10/h1-8H
InChI key:InChIKey=KXSFECAJUBPPFE-UHFFFAOYSA-N
SMILES:C=1(SC(=CC1)C2=CC=CS2)C3=CC=CS3
Synonyms:- 2,2′,2′′-Terthiophene
- 2,2′-Bithiophene, 5-(2-thienyl)-
- 2,2′:5′,2′′-Terthienyl
- 2,2′:5′,2′′-Terthiophene
- 2,5-Di(2-thienyl)thiophene
- Alpha-Terthienyl
- Trithiophene
- α-Terthienyl
- α-Terthiophene
- α-Trithienyl
- 2,2':5',2''-TERTHIOPHENE
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
2,2':5',2''-Terthiophene (purified by sublimation)
CAS:Formula:C12H8S3Purity:>99.0%(GC)Color and Shape:Light yellow to Yellow to Green powder to crystalineMolecular weight:248.382,2':5',2″-Terthiophene, 99%
CAS:<p>2,2?:5?,2??-Terthiophene undergoes electrochemical copolymerization along with carbazole and in sodium perchlorate/acetonitrile was reported. Electrochromic copolymer based on TTh and 3, 4-ethylenedioxythiophene has been reported. It acts as a monomer precursor for polythiophene and as a dopant for </p>Formula:C12H8S3Purity:99%Color and Shape:Yellow, Crystals or powder or crystalline powderMolecular weight:248.382,2':5',2''-Terthiophene
CAS:2,2':5',2''-TerthiopheneFormula:C12H8S3Purity:98%Color and Shape: yellow solidMolecular weight:248.39g/mol2,2':5',2''-Terthiophene
CAS:α-Terthiophene, an oligomer of thiophene, is used in organic semiconductor polythiophene.Formula:C12H8S3Purity:99.17%Color and Shape:Pale Yellow SolidMolecular weight:248.392,2′ :5′-2”-Terthiophene
CAS:Formula:C12H8S3Purity:98%Color and Shape:Solid, White to almost white powderMolecular weight:248.382,2':5',2''-Terthiophene
CAS:Controlled ProductFormula:C12H8S3Color and Shape:NeatMolecular weight:248.39







