CymitQuimica logo

CAS 108122-44-7

:

2-Chloro-6-(cyclopropylmethoxy)pyridine

Description:
2-Chloro-6-(cyclopropylmethoxy)pyridine is a chemical compound characterized by its pyridine ring, which is substituted at the 2-position with a chlorine atom and at the 6-position with a cyclopropylmethoxy group. This structure imparts unique properties to the molecule, influencing its reactivity and potential applications. The presence of the chlorine atom typically enhances the compound's electrophilicity, making it useful in various chemical reactions, including nucleophilic substitutions. The cyclopropylmethoxy group contributes to the compound's steric and electronic properties, potentially affecting its solubility and interaction with biological targets. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. As with many organic compounds, safety data and handling precautions should be considered, particularly due to the presence of chlorine, which can pose health risks.
Formula:C9H10ClNO
InChI:InChI=1S/C9H10ClNO/c10-8-2-1-3-9(11-8)12-6-7-4-5-7/h1-3,7H,4-6H2
InChI key:InChIKey=XBDIVNMAZGTMTR-UHFFFAOYSA-N
SMILES:C(OC=1N=C(Cl)C=CC1)C2CC2
Synonyms:
  • 2-Chloro-6-(cyclopropylmethoxy)pyridine
  • Pyridine, 2-chloro-6-(cyclopropylmethoxy)-
  • 2-Cyclopropylmethoxy-6-chloropyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.