CAS 108125-13-9

3-Ethyl-α-phenylbenzenemethanol

Description:

3-Ethyl-α-phenylbenzenemethanol, also known by its CAS number 108125-13-9, is an organic compound characterized by its complex structure, which includes an ethyl group and a phenyl group attached to a benzyl alcohol framework. This compound typically exhibits properties common to aromatic alcohols, such as moderate solubility in organic solvents and limited solubility in water due to its hydrophobic aromatic rings. The presence of the hydroxyl (-OH) group contributes to its potential as a hydrogen bond donor, influencing its reactivity and interactions with other molecules. It may exhibit moderate to high boiling and melting points relative to simpler alcohols, reflecting the influence of its bulky aromatic structure. Additionally, 3-Ethyl-α-phenylbenzenemethanol may possess interesting chemical reactivity, making it a candidate for various applications in organic synthesis, pharmaceuticals, or as an intermediate in chemical manufacturing. However, specific safety and handling guidelines should be followed, as with all chemical substances, to mitigate any potential hazards associated with its use.

Formula: C₁₅H₁₆O

InChI: InChI=1S/C15H16O/c1-2-12-7-6-10-14(11-12)15(16)13-8-4-3-5-9-13/h3-11,15-16H,2H2,1H3

InChI key: InChIKey=KFJPEGRNZOBFIU-UHFFFAOYSA-N

SMILES: C(O)(C1=CC(CC)=CC=C1)C2=CC=CC=C2

Synonyms:

• 3-Ethylbenzhydrol
• Benzhydrol, 3-ethyl-
• 3-Ethyl-α-phenylbenzenemethanol
• Benzenemethanol, 3-ethyl-α-phenyl-
• (3-Ethylphenyl)phenylmethanol