CymitQuimica logo

CAS 108129-37-9

:

4-amino-6-methylfuro[3,4-c]pyridin-3(1H)-one

Description:
4-Amino-6-methylfuro[3,4-c]pyridin-3(1H)-one is a heterocyclic organic compound characterized by its fused furo and pyridine rings, which contribute to its unique chemical properties. This compound features an amino group and a methyl group, which influence its reactivity and solubility. It is typically a crystalline solid at room temperature and may exhibit moderate to high polarity due to the presence of functional groups. The compound is of interest in medicinal chemistry, potentially serving as a scaffold for the development of pharmaceuticals. Its structure suggests that it may participate in hydrogen bonding, which can affect its interactions with biological targets. Additionally, the presence of the furo and pyridine moieties may impart specific electronic properties, making it suitable for various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Overall, 4-amino-6-methylfuro[3,4-c]pyridin-3(1H)-one is a versatile compound with potential applications in drug discovery and development.
Formula:C8H8N2O2
InChI:InChI=1/C8H8N2O2/c1-4-2-5-3-12-8(11)6(5)7(9)10-4/h2H,3H2,1H3,(H2,9,10)
SMILES:Cc1cc2COC(=O)c2c(=N)[nH]1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.