CAS 108132-34-9

N-methyl-N-phenyl-3,4-dihydro-2H-chromen-6-aminium chloride

Description:

N-methyl-N-phenyl-3,4-dihydro-2H-chromen-6-aminium chloride, with the CAS number 108132-34-9, is a chemical compound characterized by its unique structure, which includes a chromenyl moiety and a quaternary ammonium group. This compound typically exhibits properties associated with quaternary ammonium salts, such as being a cationic surfactant, which can enhance solubility in aqueous solutions and facilitate interactions with biological membranes. It may also display antimicrobial or antifungal activity, making it of interest in various applications, including pharmaceuticals and agrochemicals. The presence of the methyl and phenyl groups contributes to its lipophilicity, potentially influencing its bioavailability and interaction with cellular targets. Additionally, the chloride ion serves as a counterion, which can affect the compound's stability and solubility. Overall, N-methyl-N-phenyl-3,4-dihydro-2H-chromen-6-aminium chloride is a versatile compound with potential utility in both research and industrial applications.

Formula: C₁₆H₁₈ClNO

InChI: InChI=1/C16H17NO.ClH/c1-17(14-7-3-2-4-8-14)15-9-10-16-13(12-15)6-5-11-18-16;/h2-4,7-10,12H,5-6,11H2,1H3;1H

SMILES: CN(c1ccccc1)c1ccc2c(CCCO2)c1.Cl

3,4-Dihydro-2H-1-benzopyran-6-yl(phenyl)methanamine hydrochloride

CAS: 108132-34-9

Versatile small molecule scaffold

Formula: C₁₆H₁₈ClNO

Purity: Min. 95%

Molecular weight: 275.77 g/mol

Ref: 3D-IEA13234