
CAS 108149-59-3
:2-[2-[2-(4-Nonylphenoxy)ethoxy]ethoxy]acetic acid
Description:
2-[2-[2-(4-Nonylphenoxy)ethoxy]ethoxy]acetic acid, with the CAS number 108149-59-3, is a chemical compound characterized by its complex structure that includes a nonylphenyl group, which contributes to its hydrophobic properties. This compound features multiple ethoxy groups, enhancing its solubility in organic solvents and its potential for surfactant applications. The presence of the acetic acid moiety suggests that it may exhibit acidic properties, which can influence its reactivity and interactions in various chemical environments. Typically, compounds like this are utilized in formulations for detergents, emulsifiers, or as intermediates in organic synthesis. Its nonylphenyl component may raise environmental concerns due to potential endocrine-disrupting effects, prompting regulatory scrutiny. Overall, this compound's unique structure imparts specific physical and chemical properties that make it suitable for various industrial applications while also necessitating careful consideration of its environmental impact.
Formula:C21H34O5
InChI:InChI=1S/C21H34O5/c1-2-3-4-5-6-7-8-9-19-10-12-20(13-11-19)26-17-16-24-14-15-25-18-21(22)23/h10-13H,2-9,14-18H2,1H3,(H,22,23)
InChI key:InChIKey=JYQIQTZWGQBTGK-UHFFFAOYSA-N
SMILES:O(CCOCCOCC(O)=O)C1=CC=C(CCCCCCCCC)C=C1
Synonyms:- Acetic acid, [2-[2-(4-nonylphenoxy)ethoxy]ethoxy]-
- Acetic acid, 2-[2-[2-(4-nonylphenoxy)ethoxy]ethoxy]-
- 2-[2-[2-(4-Nonylphenoxy)ethoxy]ethoxy]acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
