CAS 108157-27-3

N-(2-methylbenzyl)cyclopentanamine

Description:

N-(2-methylbenzyl)cyclopentanamine is an organic compound characterized by its unique structure, which includes a cyclopentanamine core substituted with a 2-methylbenzyl group. This compound features a cyclopentane ring, which contributes to its cyclic structure, and an amine functional group, indicating the presence of nitrogen. The 2-methylbenzyl substituent introduces aromatic characteristics due to the benzene ring, along with a methyl group that can influence the compound's reactivity and solubility. The presence of the amine group suggests potential basicity and the ability to form hydrogen bonds, which can affect its interactions in various chemical environments. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its specific physical properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the overall molecular weight. As with many organic compounds, safety and handling precautions should be observed, particularly due to the potential for biological activity associated with amines.

Formula: C₁₃H₁₉N

InChI: InChI=1/C13H19N/c1-11-6-2-3-7-12(11)10-14-13-8-4-5-9-13/h2-3,6-7,13-14H,4-5,8-10H2,1H3

SMILES: Cc1ccccc1CNC1CCCC1