CymitQuimica logo

CAS 108158-06-1

:

4,5-Dichloro-2-thiophenesulfonyl fluoride

Description:
4,5-Dichloro-2-thiophenesulfonyl fluoride is a chemical compound characterized by its unique structure, which includes a thiophene ring substituted with two chlorine atoms and a sulfonyl fluoride group. This compound is typically a solid at room temperature and is known for its reactivity, particularly due to the presence of the sulfonyl fluoride functional group, which can act as a potent electrophile in various chemical reactions. It is often utilized in organic synthesis and medicinal chemistry, serving as an important intermediate in the development of pharmaceuticals and agrochemicals. The dichloro substitution enhances its electrophilic properties, making it useful in nucleophilic substitution reactions. Additionally, the compound may exhibit specific physical properties such as solubility in organic solvents and stability under certain conditions, although it may be sensitive to moisture and air. Safety precautions are essential when handling this compound, as it may pose health risks if inhaled or ingested, and appropriate protective measures should be taken to mitigate exposure.
Formula:C4HCl2FO2S2
InChI:InChI=1S/C4HCl2FO2S2/c5-2-1-3(10-4(2)6)11(7,8)9/h1H
InChI key:InChIKey=CTFSVTLSIBOOMZ-UHFFFAOYSA-N
SMILES:S(F)(=O)(=O)C1=CC(Cl)=C(Cl)S1
Synonyms:
  • 4,5-Dichloro-2-thiophenesulfonyl fluoride
  • 2-Thiophenesulfonyl fluoride, 4,5-dichloro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.