CAS 108161-12-2: 3,5-Dimethyl-1H-pyrazole-4-carbonitrile

Description:3,5-Dimethyl-1H-pyrazole-4-carbonitrile is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. The presence of two methyl groups at the 3 and 5 positions of the pyrazole ring contributes to its hydrophobic properties and influences its reactivity. The carbonitrile functional group at the 4 position introduces a polar character, making the compound more soluble in polar solvents. This compound is often utilized in various chemical syntheses and has applications in agrochemicals and pharmaceuticals due to its potential biological activity. Its molecular structure allows for various substitution reactions, making it a versatile intermediate in organic synthesis. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the methyl groups and the carbonitrile group, which can participate in nucleophilic and electrophilic reactions. Overall, 3,5-Dimethyl-1H-pyrazole-4-carbonitrile is a significant compound in the field of organic chemistry with diverse applications.

Formula:C₆H₇N₃

InChI:InChI=1S/C6H7N3/c1-4-6(3-7)5(2)9-8-4/h1-2H3,(H,8,9)

Found 3 products.

Product data	Purity	Price range	Estimated delivery
3,5-dimethyl-1H-pyrazole-4-carbonitrile REF: IN-DA0092Y6CAS: 108161-12-2	97%	To inquire	Thu 13 Mar 25
3,5-Dimethyl-1H-pyrazole-4-carbonitrile REF: 10-F335414CAS: 108161-12-2	95.0%	To inquire	Tue 25 Mar 25
3,5-Dimethyl-1H-pyrazole-4-carbonitrile REF: 3D-IEA16112CAS: 108161-12-2	Min. 95%	- - -	Discontinued product