CymitQuimica logo

CAS 108180-05-8

:

trans-4-[(4-Oxo-3(4H)-quinazolinyl)methyl]cyclohexanecarboxylic acid

Description:
Trans-4-[(4-Oxo-3(4H)-quinazolinyl)methyl]cyclohexanecarboxylic acid is a chemical compound characterized by its unique structure, which includes a cyclohexane ring and a quinazoline moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in organic solvents depending on the specific functional groups present. The presence of the carboxylic acid group suggests that it can participate in acid-base reactions and may form salts with bases. Additionally, the quinazoline structure is known for its biological activity, which may include antimicrobial or anticancer properties. The compound may also exhibit specific melting and boiling points, as well as distinct spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Overall, this compound's unique structural features contribute to its potential applications in pharmaceuticals and medicinal chemistry.
Formula:C16H18N2O3
InChI:InChI=1/C16H18N2O3/c19-15-13-3-1-2-4-14(13)17-10-18(15)9-11-5-7-12(8-6-11)16(20)21/h1-4,10-12H,5-9H2,(H,20,21)/t11-,12-
InChI key:InChIKey=NBFRLAFUANZFTR-HAQNSBGRNA-N
SMILES:O=C1C=2C(N=CN1C[C@H]3CC[C@H](C(O)=O)CC3)=CC=CC2
Synonyms:
  • Cyclohexanecarboxylic acid, 4-[(4-oxo-3(4H)-quinazolinyl)methyl]-, trans-
  • trans-4-[(4-Oxo-3(4H)-quinazolinyl)methyl]cyclohexanecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.