CymitQuimica logo

CAS 108180-63-8

:

4-[[(tert-Butoxy)carbonyl]amino]-3-thiophenecarboxylic acid

Description:
4-[[(tert-Butoxy)carbonyl]amino]-3-thiophenecarboxylic acid, with CAS number 108180-63-8, is an organic compound characterized by its functional groups and structural features. It contains a thiophene ring, which is a five-membered aromatic heterocycle featuring sulfur, contributing to its unique chemical properties. The presence of a tert-butoxycarbonyl (Boc) group indicates that it is likely used as a protecting group in peptide synthesis, allowing for selective reactions without interfering with the amino group. The carboxylic acid functionality provides acidic properties, enabling it to participate in various chemical reactions, such as esterification or amidation. This compound is typically utilized in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals. Its solubility and reactivity can be influenced by the presence of the thiophene ring and the Boc group, making it a versatile intermediate in synthetic pathways. Overall, this compound exemplifies the intersection of heterocyclic chemistry and functional group manipulation in organic synthesis.
Formula:C10H13NO4S
InChI:InChI=1/C10H13NO4S/c1-10(2,3)15-9(14)11-7-5-16-4-6(7)8(12)13/h4-5H,1-3H3,(H,11,14)(H,12,13)
SMILES:CC(C)(C)OC(=Nc1cscc1C(=O)O)O
Synonyms:
  • 4-[(Tert-Butoxycarbonyl)Amino]Thiophene-3-Carboxylic Acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.