
CAS 1081809-78-0
:2-Chloro-4-methyl-5-nitrobenzenamine
Description:
2-Chloro-4-methyl-5-nitrobenzenamine, identified by its CAS number 1081809-78-0, is an organic compound characterized by the presence of a chloro group, a methyl group, and a nitro group attached to a benzene ring that also contains an amine functional group. This compound typically appears as a solid and is soluble in organic solvents, reflecting its aromatic nature. The presence of the nitro group contributes to its potential reactivity, particularly in electrophilic substitution reactions. The chloro substituent can influence the compound's electronic properties and steric hindrance, affecting its reactivity and interactions with other chemical species. Additionally, the amine group can participate in hydrogen bonding, which may impact its solubility and stability in various environments. Due to these characteristics, 2-Chloro-4-methyl-5-nitrobenzenamine may find applications in organic synthesis, particularly in the development of dyes, pharmaceuticals, or agrochemicals. However, handling and usage should be approached with caution due to potential toxicity and environmental concerns associated with nitro compounds.
Formula:C7H7ClN2O2
InChI:InChI=1S/C7H7ClN2O2/c1-4-2-5(8)6(9)3-7(4)10(11)12/h2-3H,9H2,1H3
InChI key:InChIKey=XYGMPRCMGJKLBC-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C)C=C(Cl)C(N)=C1
Synonyms:- Benzenamine, 2-chloro-4-methyl-5-nitro-
- 2-Chloro-4-methyl-5-nitrobenzenamine
- 2-Chloro-4-methyl-5-nitroaniline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.