CymitQuimica logo

CAS 1082040-18-3

:

3-Formyl-1H-pyrrolo[2,3-b]pyridine-6-carbonitrile

Description:
3-Formyl-1H-pyrrolo[2,3-b]pyridine-6-carbonitrile is a heterocyclic organic compound characterized by its complex structure, which includes a pyrrole and pyridine moiety. This compound features a formyl group (-CHO) and a cyano group (-CN) attached to the pyrrolo-pyridine framework, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the formyl group suggests that it can participate in various chemical reactions, such as condensation and nucleophilic addition, while the cyano group can serve as a versatile functional handle for further modifications. The compound's unique structure may impart interesting biological activities, making it a candidate for research in drug development. Additionally, its solubility and stability in various solvents can influence its practical applications in laboratory settings. Overall, 3-Formyl-1H-pyrrolo[2,3-b]pyridine-6-carbonitrile is a valuable compound for chemists interested in exploring novel synthetic pathways and potential therapeutic agents.
Formula:C9H5N3O
InChI:InChI=1S/C9H5N3O/c10-3-7-1-2-8-6(5-13)4-11-9(8)12-7/h1-2,4-5H,(H,11,12)
InChI key:InChIKey=PWRRHJGFGZJDNQ-UHFFFAOYSA-N
SMILES:C(=O)C=1C=2C(=NC(C#N)=CC2)NC1
Synonyms:
  • 3-Formyl-1H-pyrrolo[2,3-b]pyridine-6-carbonitrile
  • 1H-Pyrrolo[2,3-b]pyridine-6-carbonitrile, 3-formyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.