CAS 1082040-28-5
:3-Iodo-1H-indazol-7-ol
Description:
3-Iodo-1H-indazol-7-ol is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of an iodine atom at the 3-position and a hydroxyl group (-OH) at the 7-position contributes to its unique reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the hydroxyl group. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as indazole derivatives have been studied for their anti-inflammatory, anticancer, and antimicrobial properties. The compound's reactivity can be influenced by the iodine substituent, which may participate in nucleophilic substitution reactions or serve as a leaving group in various synthetic pathways. Additionally, the presence of the hydroxyl group can enhance hydrogen bonding interactions, affecting its physical properties and biological interactions. Overall, 3-Iodo-1H-indazol-7-ol represents a versatile scaffold for further chemical exploration and development.
Formula:C7H5IN2O
InChI:InChI=1S/C7H5IN2O/c8-7-4-2-1-3-5(11)6(4)9-10-7/h1-3,11H,(H,9,10)
InChI key:InChIKey=DDYSBUFMYIDIQL-UHFFFAOYSA-N
SMILES:OC1=C2C(C(I)=NN2)=CC=C1
Synonyms:- 3-Iodo-1H-indazol-7-ol
- 1H-Indazol-7-ol, 3-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.