
CAS 1082040-29-6
:4-Piperidinecarboxylic acid, 4-methoxy-
Description:
4-Piperidinecarboxylic acid, 4-methoxy- is an organic compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a carboxylic acid functional group (-COOH) at the 4-position of the piperidine ring, contributing to its acidity and reactivity. The presence of a methoxy group (-OCH3) at the same position enhances its solubility in organic solvents and may influence its biological activity. This compound is typically a white to off-white solid and is soluble in polar solvents due to the carboxylic acid group. It may be used in various chemical syntheses and research applications, particularly in medicinal chemistry, where modifications to piperidine derivatives can lead to compounds with potential pharmacological properties. As with many organic compounds, safety precautions should be observed when handling it, as it may pose health risks if ingested or inhaled.
Formula:C7H13NO3
InChI:InChI=1S/C7H13NO3/c1-11-7(6(9)10)2-4-8-5-3-7/h8H,2-5H2,1H3,(H,9,10)
InChI key:InChIKey=WJACJJKVFSLPJH-UHFFFAOYSA-N
SMILES:C(O)(=O)C1(OC)CCNCC1
Synonyms:- 4-Methoxypiperidine-4-carboxylic acid
- 4-Piperidinecarboxylic acid, 4-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.