CymitQuimica logo

CAS 1082040-36-5

:

4-Methoxy-1-methyl-4-piperidinecarbonitrile

Description:
4-Methoxy-1-methyl-4-piperidinecarbonitrile is a chemical compound characterized by its piperidine ring structure, which includes a methoxy group and a cyano group. The presence of the methoxy group (-OCH3) contributes to its polar nature, potentially influencing its solubility in various solvents. The cyano group (-C≡N) is known for its reactivity and can participate in various chemical reactions, making this compound of interest in synthetic organic chemistry. The molecular structure suggests that it may exhibit biological activity, which could be relevant in pharmaceutical applications. Additionally, the compound's CAS number, 1082040-36-5, allows for precise identification and retrieval of information in chemical databases. As with many organic compounds, its physical properties such as melting point, boiling point, and density would depend on the specific conditions and purity of the sample. Safety data should be consulted to understand any potential hazards associated with handling this substance. Overall, 4-Methoxy-1-methyl-4-piperidinecarbonitrile presents a unique combination of functional groups that may lend itself to various applications in research and industry.
Formula:C8H14N2O
InChI:InChI=1S/C8H14N2O/c1-10-5-3-8(7-9,11-2)4-6-10/h3-6H2,1-2H3
InChI key:InChIKey=DEVSIRRQLCZFEH-UHFFFAOYSA-N
SMILES:C(#N)C1(OC)CCN(C)CC1
Synonyms:
  • 4-Piperidinecarbonitrile, 4-methoxy-1-methyl-
  • 4-Methoxy-1-methyl-4-piperidinecarbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.