CAS 1082040-46-7
:Phenol, 3-bromo-5-chloro-2-methyl-
Description:
Phenol, 3-bromo-5-chloro-2-methyl- is an organic compound characterized by the presence of a phenolic hydroxyl group (-OH) attached to a benzene ring, along with bromine and chlorine substituents at specific positions on the ring. The compound features a methyl group (-CH3) that contributes to its overall structure and reactivity. The presence of halogens (bromine and chlorine) typically enhances the compound's reactivity, making it useful in various chemical syntheses and applications. This compound may exhibit properties such as moderate solubility in organic solvents and potential biological activity, which can be influenced by the arrangement of substituents on the aromatic ring. Additionally, the presence of the hydroxyl group suggests that it may participate in hydrogen bonding, affecting its physical properties like boiling and melting points. As with many halogenated phenols, safety precautions should be taken due to potential toxicity and environmental impact. Overall, this compound is of interest in both synthetic organic chemistry and materials science.
Formula:C7H6BrClO
InChI:InChI=1S/C7H6BrClO/c1-4-6(8)2-5(9)3-7(4)10/h2-3,10H,1H3
InChI key:InChIKey=SZTOIROWIFCPRY-UHFFFAOYSA-N
SMILES:CC1=C(Br)C=C(Cl)C=C1O
Synonyms:- Phenol, 3-bromo-5-chloro-2-methyl-
- 3-Bromo-5-chloro-2-methylphenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.