CAS 1082040-49-0

2-Bromo-4-fluoro-6-nitrobenzeneacetonitrile

Description:

2-Bromo-4-fluoro-6-nitrobenzeneacetonitrile is an organic compound characterized by its complex structure, which includes a benzene ring substituted with bromine, fluorine, and nitro groups, along with an acetonitrile functional group. The presence of these substituents contributes to its unique chemical properties, such as increased reactivity and polarity. The bromine and fluorine atoms are known for their electronegative characteristics, which can influence the compound's reactivity in nucleophilic substitution reactions. The nitro group is a strong electron-withdrawing group, enhancing the compound's electrophilic nature. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and purity of the sample. Safety precautions should be taken when handling this compound, as it may pose health risks due to its halogenated and nitro functionalities.

Formula: C₈H₄BrFN₂O₂

InChI: InChI=1S/C8H4BrFN2O2/c9-7-3-5(10)4-8(12(13)14)6(7)1-2-11/h3-4H,1H2

InChI key: InChIKey=UVEGHALODGFVGT-UHFFFAOYSA-N

SMILES: C(C#N)C1=C(N(=O)=O)C=C(F)C=C1Br

Synonyms:

• 2-Bromo-4-fluoro-6-nitrobenzeneacetonitrile
• Benzeneacetonitrile, 2-bromo-4-fluoro-6-nitro-