CAS 1082040-52-5
:3-Bromo-4-methyl-5-nitro-1H-indazole
Description:
3-Bromo-4-methyl-5-nitro-1H-indazole is a heterocyclic organic compound characterized by its indazole core, which consists of a fused benzene and pyrazole ring. The presence of a bromine atom at the 3-position, a methyl group at the 4-position, and a nitro group at the 5-position contributes to its unique chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit a range of colors depending on its purity and crystalline form. It is likely to be soluble in organic solvents such as dimethyl sulfoxide (DMSO) and dimethylformamide (DMF), but less soluble in water due to its hydrophobic indazole structure. The nitro group introduces significant electron-withdrawing characteristics, which can influence the compound's reactivity in electrophilic substitution reactions. Additionally, the bromine atom can serve as a site for further chemical modifications, making this compound of interest in synthetic organic chemistry and potentially in pharmaceutical applications. Safety precautions should be observed when handling this compound due to its potential toxicity and reactivity.
Formula:C8H6BrN3O2
InChI:InChI=1S/C8H6BrN3O2/c1-4-6(12(13)14)3-2-5-7(4)8(9)11-10-5/h2-3H,1H3,(H,10,11)
InChI key:InChIKey=QHNIQCJTDMEPES-UHFFFAOYSA-N
SMILES:CC1=C2C(=CC=C1N(=O)=O)NN=C2Br
Synonyms:- 3-Bromo-4-methyl-5-nitro-2H-indazole
- 3-Bromo-4-methyl-5-nitro-1H-indazole
- 1H-Indazole, 3-bromo-4-methyl-5-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.