CAS 1082040-53-6
:6-Hydroxy-1H-indole-4-carbonitrile
Description:
6-Hydroxy-1H-indole-4-carbonitrile is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a hydroxyl group (-OH) at the 6-position and a cyano group (-C≡N) at the 4-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit solubility in polar solvents due to the hydroxyl group. It can participate in various chemical reactions, including nucleophilic substitutions and cyclization, making it of interest in synthetic organic chemistry. The cyano group can also serve as a versatile functional group for further transformations. Additionally, compounds with indole structures are often studied for their biological activities, including potential pharmaceutical applications. The specific reactivity and stability of 6-Hydroxy-1H-indole-4-carbonitrile can be influenced by factors such as pH and the presence of other functional groups in a reaction environment. Overall, this compound represents a valuable building block in the synthesis of more complex organic molecules.
Formula:C9H6N2O
InChI:InChI=1S/C9H6N2O/c10-5-6-3-7(12)4-9-8(6)1-2-11-9/h1-4,11-12H
InChI key:InChIKey=AUCRMXTVWCXBBK-UHFFFAOYSA-N
SMILES:C(#N)C1=C2C(=CC(O)=C1)NC=C2
Synonyms:- 6-Hydroxy-1H-indole-4-carbonitrile
- 1H-Indole-4-carbonitrile, 6-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
