CAS 1082040-54-7
:Methyl 6-hydroxy-1H-indazole-3-carboxylate
Description:
Methyl 6-hydroxy-1H-indazole-3-carboxylate is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a hydroxyl group (-OH) at the 6-position and a carboxylate ester group (-COOCH3) at the 3-position, contributing to its reactivity and potential biological activity. The presence of the hydroxyl group enhances its solubility in polar solvents and may influence its interaction with biological targets. Methyl 6-hydroxy-1H-indazole-3-carboxylate is of interest in medicinal chemistry due to its potential applications in drug development, particularly in the fields of anti-inflammatory and anticancer research. Its molecular structure allows for various synthetic modifications, which can lead to derivatives with enhanced pharmacological properties. As with many indazole derivatives, it may exhibit interesting pharmacokinetic profiles, making it a subject of study in the development of new therapeutic agents. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C9H8N2O3
InChI:InChI=1S/C9H8N2O3/c1-14-9(13)8-6-3-2-5(12)4-7(6)10-11-8/h2-4,12H,1H3,(H,10,11)
InChI key:InChIKey=SCZCVGGFXRTPII-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C=2C(NN1)=CC(O)=CC2
Synonyms:- 1H-Indazole-3-carboxylic acid, 6-hydroxy-, methyl ester
- Methyl 6-hydroxy-1H-indazole-3-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.