CAS 1082040-56-9

3-Bromo-5,7-dinitro-1H-indazole

Description:

3-Bromo-5,7-dinitro-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of bromine and nitro groups significantly influences its chemical properties and reactivity. The bromine atom, being a halogen, can participate in nucleophilic substitution reactions, while the nitro groups are known for their electron-withdrawing effects, which can enhance the compound's electrophilicity. This compound may exhibit various physical properties such as solubility in organic solvents, and its stability can be affected by the presence of the nitro groups, which can also impart explosive characteristics under certain conditions. Additionally, the compound's potential applications may include use in pharmaceuticals, agrochemicals, or as a synthetic intermediate in organic chemistry. Safety precautions should be taken when handling this compound due to the presence of nitro groups, which can pose risks of toxicity and environmental hazards.

Formula: C₇H₃BrN₄O₄

InChI: InChI=1S/C7H3BrN4O4/c8-7-4-1-3(11(13)14)2-5(12(15)16)6(4)9-10-7/h1-2H,(H,9,10)

InChI key: InChIKey=NDRSOQNJXXJCLP-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C2C(=CC(N(=O)=O)=C1)C(Br)=NN2

Synonyms:

• 3-Bromo-5,7-dinitro-1H-indazole
• 1H-Indazole, 3-bromo-5,7-dinitro-