CAS 1082040-58-1
:5-Methoxy-2-methyl-3-nitrobenzonitrile
Description:
5-Methoxy-2-methyl-3-nitrobenzonitrile is an organic compound characterized by its aromatic structure, which includes a methoxy group, a methyl group, and a nitro group attached to a benzonitrile framework. The presence of the methoxy group (-OCH3) typically enhances the compound's solubility in organic solvents and can influence its reactivity and interaction with other molecules. The nitro group (-NO2) is known for its electron-withdrawing properties, which can affect the compound's electrophilicity and overall reactivity in chemical reactions. The benzonitrile moiety contributes to the compound's stability and can also serve as a functional group in various synthetic applications. This compound may exhibit interesting biological activities, making it of interest in pharmaceutical research. Additionally, its physical properties, such as melting point, boiling point, and solubility, would be influenced by the substituents on the aromatic ring. Overall, 5-Methoxy-2-methyl-3-nitrobenzonitrile is a versatile compound with potential applications in organic synthesis and medicinal chemistry.
Formula:C9H8N2O3
InChI:InChI=1S/C9H8N2O3/c1-6-7(5-10)3-8(14-2)4-9(6)11(12)13/h3-4H,1-2H3
InChI key:InChIKey=HOIVPMZFHOWUBR-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C)C(C#N)=CC(OC)=C1
Synonyms:- 5-Methoxy-2-methyl-3-nitrobenzonitrile
- Benzonitrile, 5-methoxy-2-methyl-3-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
