CAS 1082040-68-3
:4,6-Dimethoxy-1H-indole-2,3-dione 3-hydrazone
Description:
4,6-Dimethoxy-1H-indole-2,3-dione 3-hydrazone is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This substance features two methoxy groups at the 4 and 6 positions of the indole ring, contributing to its unique reactivity and solubility properties. The presence of the hydrazone functional group indicates that it is formed through the condensation of a hydrazine derivative with an aldehyde or ketone, which in this case is derived from the indole-2,3-dione moiety. This compound may exhibit biological activity, potentially serving as a precursor for various pharmaceuticals or agrochemicals. Its properties, such as melting point, solubility, and stability, can be influenced by the methoxy substituents and the hydrazone linkage. As with many organic compounds, it is essential to handle it with care, considering safety protocols due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its applications and mechanisms of action.
Formula:C10H11N3O3
InChI:InChI=1S/C10H11N3O3/c1-15-5-3-6-8(7(4-5)16-2)9(13-11)10(14)12-6/h3-4H,11H2,1-2H3,(H,12,13,14)
InChI key:InChIKey=GYKWTGRKPOITEB-UHFFFAOYSA-N
SMILES:N(N)=C1C=2C(=CC(OC)=CC2OC)NC1=O
Synonyms:- 4,6-Dimethoxy-1H-indole-2,3-dione 3-hydrazone
- 1H-Indole-2,3-dione, 4,6-dimethoxy-, 3-hydrazone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.