CymitQuimica logo

CAS 1082040-76-3

:

(5-Benzyloxy-2-nitro-phenyl)-acetic acid methyl ester

Description:
(5-Benzyloxy-2-nitro-phenyl)-acetic acid methyl ester is an organic compound characterized by its complex structure, which includes a nitro group, a benzyloxy group, and an acetic acid methyl ester moiety. This compound typically exhibits a yellow to orange color due to the presence of the nitro group, which can also influence its reactivity and solubility. It is likely to be soluble in organic solvents such as ethanol and dichloromethane, while being less soluble in water due to its hydrophobic components. The presence of the nitro group suggests potential for electrophilic substitution reactions, while the ester functionality may undergo hydrolysis under acidic or basic conditions. This compound may be of interest in medicinal chemistry and organic synthesis, particularly for its potential biological activities or as an intermediate in the synthesis of more complex molecules. Safety precautions should be taken when handling this substance, as nitro compounds can be hazardous.
Formula:C16H15NO5
InChI:InChI=1S/C16H15NO5/c1-21-16(18)10-13-9-14(7-8-15(13)17(19)20)22-11-12-5-3-2-4-6-12/h2-9H,10-11H2,1H3
InChI key:HRWGHLSKSOYUJA-UHFFFAOYSA-N
SMILES:COC(=O)CC1=C(C=CC(=C1)OCC2=CC=CC=C2)[N+](=O)[O-]
Found 0 products.