CymitQuimica logo

CAS 1082040-79-6

:

4-Bromo-6-iodo-7-methyl-1H-indole

Description:
4-Bromo-6-iodo-7-methyl-1H-indole is a heterocyclic organic compound belonging to the indole family, characterized by a fused bicyclic structure containing a benzene ring and a pyrrole ring. This compound features bromine and iodine substituents at the 4 and 6 positions, respectively, along with a methyl group at the 7 position, which influences its chemical reactivity and physical properties. The presence of halogens typically enhances the compound's reactivity, making it useful in various synthetic applications, including medicinal chemistry and material science. 4-Bromo-6-iodo-7-methyl-1H-indole may exhibit biological activity, potentially serving as a scaffold for drug development. Its molecular structure contributes to its solubility and stability in different solvents, which is crucial for its application in laboratory settings. Additionally, the compound's unique combination of substituents may impart specific electronic properties, affecting its interaction with biological targets or other chemical species. Overall, this compound represents a valuable entity in the study of indole derivatives and their applications in various fields of research.
Formula:C9H7BrIN
InChI:InChI=1S/C9H7BrIN/c1-5-8(11)4-7(10)6-2-3-12-9(5)6/h2-4,12H,1H3
InChI key:InChIKey=YPKFQHZIXXSKSH-UHFFFAOYSA-N
SMILES:CC1=C2C(=C(Br)C=C1I)C=CN2
Synonyms:
  • 4-Bromo-6-iodo-7-methyl-1H-indole
  • 1H-Indole, 4-bromo-6-iodo-7-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.