CymitQuimica logo

CAS 1082040-81-0

:

4-Bromo-6-methoxy-7-methyl-1H-indole

Description:
4-Bromo-6-methoxy-7-methyl-1H-indole is a chemical compound belonging to the indole family, characterized by its bicyclic structure that includes a fused benzene and pyrrole ring. This compound features a bromine atom at the 4-position, a methoxy group (-OCH3) at the 6-position, and a methyl group (-CH3) at the 7-position of the indole ring. The presence of these substituents influences its chemical reactivity and physical properties, such as solubility and boiling point. Indoles are known for their biological activity, and modifications like those in 4-Bromo-6-methoxy-7-methyl-1H-indole can enhance or alter their pharmacological properties. The compound may exhibit potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Additionally, its bromine and methoxy groups can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. As with many indole derivatives, it may also display interesting optical and electronic properties, which could be relevant in materials science.
Formula:C10H10BrNO
InChI:InChI=1S/C10H10BrNO/c1-6-9(13-2)5-8(11)7-3-4-12-10(6)7/h3-5,12H,1-2H3
InChI key:InChIKey=WCPSPCHZYUMBGY-UHFFFAOYSA-N
SMILES:CC1=C2C(=C(Br)C=C1OC)C=CN2
Synonyms:
  • 4-Bromo-6-methoxy-7-methyl-1H-indole
  • 1H-Indole, 4-bromo-6-methoxy-7-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.