CAS 1082040-84-3

4,6-Dibromo-7-methyl-1H-indole

Description:

4,6-Dibromo-7-methyl-1H-indole is a chemical compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of bromine substituents at the 4 and 6 positions, along with a methyl group at the 7 position, contributes to its unique reactivity and properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the solvent's polarity. The bromine atoms enhance its electrophilic character, making it useful in various chemical reactions, including substitution and coupling reactions. Additionally, the indole moiety is known for its biological significance, often serving as a scaffold in pharmaceuticals and agrochemicals. The compound's molecular structure suggests potential applications in materials science and organic synthesis, particularly in the development of novel compounds with specific electronic or optical properties. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.

Formula: C₉H₇Br₂N

InChI: InChI=1S/C9H7Br2N/c1-5-7(10)4-8(11)6-2-3-12-9(5)6/h2-4,12H,1H3

InChI key: InChIKey=MVLGUULQDBXCKP-UHFFFAOYSA-N

SMILES: CC1=C2C(=C(Br)C=C1Br)C=CN2

Synonyms:

• 1H-Indole, 4,6-dibromo-7-methyl-
• 4,6-Dibromo-7-methyl-1H-indole