CAS 1082040-88-7

6-Chloro-7-methyl-1H-pyrrolo[3,2-c]pyridine

Description:

6-Chloro-7-methyl-1H-pyrrolo[3,2-c]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 6-position and a methyl group at the 7-position enhances its reactivity and solubility in various organic solvents. This compound typically exhibits a pale yellow to brownish appearance and has a relatively low molecular weight. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The compound's structure allows for various substitution reactions, making it a versatile intermediate in organic synthesis. Additionally, its stability under standard laboratory conditions makes it suitable for further chemical modifications. As with many heterocycles, it may exhibit interesting electronic properties, which can be exploited in material science and drug design. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks.

Formula: C₈H₇ClN₂

InChI: InChI=1S/C8H7ClN2/c1-5-7-6(2-3-10-7)4-11-8(5)9/h2-4,10H,1H3

InChI key: InChIKey=SQJKCHGMQRSOIE-UHFFFAOYSA-N

SMILES: CC1=C2C(=CN=C1Cl)C=CN2

Synonyms:

• 1H-Pyrrolo[3,2-c]pyridine, 6-chloro-7-methyl-
• 6-Chloro-7-methyl-1H-pyrrolo[3,2-c]pyridine

6-Chloro-7-methyl-1H-pyrrolo[3,2-c]pyridine

CAS: 1082040-88-7

Formula: C₈H₇ClN₂

Molecular weight: 166.6076

Ref: IN-DA0099AF