CAS 1082041-02-8

7-Methyl-1H-pyrrolo[3,2-c]pyridine-4-carboxylic acid

Description:

7-Methyl-1H-pyrrolo[3,2-c]pyridine-4-carboxylic acid is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound features a carboxylic acid functional group, which enhances its acidity and solubility in polar solvents. The presence of the methyl group at the 7-position of the pyrrole ring influences its reactivity and potential biological activity. Typically, compounds of this class may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can be significant in biological systems. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the nitrogen atoms in the ring system. Overall, 7-Methyl-1H-pyrrolo[3,2-c]pyridine-4-carboxylic acid represents a valuable scaffold for further chemical modifications and potential applications in drug development.

Formula: C₉H₈N₂O₂

InChI: InChI=1S/C9H8N2O2/c1-5-4-11-8(9(12)13)6-2-3-10-7(5)6/h2-4,10H,1H3,(H,12,13)

InChI key: InChIKey=HHSBOPLXPGEKCF-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2C(=C(C)C=N1)NC=C2

Synonyms:

• 7-Methyl-1H-pyrrolo[3,2-c]pyridine-4-carboxylic acid
• 1H-Pyrrolo[3,2-c]pyridine-4-carboxylic acid, 7-methyl-