
CAS 1082041-08-4
:7-Methyl-1H-pyrrolo[3,2-c]pyridine-6-carbonitrile
Description:
7-Methyl-1H-pyrrolo[3,2-c]pyridine-6-carbonitrile is a heterocyclic organic compound characterized by its unique bicyclic structure, which consists of a pyrrole and a pyridine ring fused together. The presence of a methyl group at the 7-position and a cyano group at the 6-position contributes to its chemical reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential biological activity, making it of interest in drug discovery and development. The cyano group can participate in various chemical reactions, including nucleophilic additions and cycloadditions, which may lead to the synthesis of more complex molecules. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on the specific conditions and purity. Overall, 7-Methyl-1H-pyrrolo[3,2-c]pyridine-6-carbonitrile represents a valuable scaffold for further exploration in chemical research and pharmaceutical applications.
Formula:C9H7N3
InChI:InChI=1S/C9H7N3/c1-6-8(4-10)12-5-7-2-3-11-9(6)7/h2-3,5,11H,1H3
InChI key:InChIKey=UBGODBQKBNTMMY-UHFFFAOYSA-N
SMILES:CC1=C2C(=CN=C1C#N)C=CN2
Synonyms:- 1H-Pyrrolo[3,2-c]pyridine-6-carbonitrile, 7-methyl-
- 7-Methyl-1H-pyrrolo[3,2-c]pyridine-6-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.