CAS 1082041-19-7

3-Bromo-4-nitro-1H-indazol-6-ol

Description:

3-Bromo-4-nitro-1H-indazol-6-ol is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a bromine atom at the 3-position and a nitro group at the 4-position contributes to its reactivity and potential applications in various chemical reactions. The hydroxyl group (-OH) at the 6-position enhances its solubility in polar solvents and can participate in hydrogen bonding, influencing its biological activity and interaction with other molecules. This compound may exhibit properties such as antimicrobial or anticancer activity, making it of interest in medicinal chemistry. Its molecular structure allows for various synthetic modifications, which can lead to derivatives with altered pharmacological profiles. As with many brominated and nitro-substituted compounds, it is essential to handle 3-Bromo-4-nitro-1H-indazol-6-ol with care due to potential toxicity and environmental concerns associated with halogenated and nitro compounds.

Formula: C₇H₄BrN₃O₃

InChI: InChI=1S/C7H4BrN3O3/c8-7-6-4(9-10-7)1-3(12)2-5(6)11(13)14/h1-2,12H,(H,9,10)

InChI key: InChIKey=SNFJFZLVOBRRJW-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C2C(NN=C2Br)=CC(O)=C1

Synonyms:

• 1H-Indazol-6-ol, 3-bromo-4-nitro-
• 3-Bromo-4-nitro-1H-indazol-6-ol