CymitQuimica logo

CAS 1082041-28-8

:

1,3-Dihydro-4-methoxy-1-(phenylmethyl)-2H-pyrrolo[3,2-c]pyridin-2-one

Description:
1,3-Dihydro-4-methoxy-1-(phenylmethyl)-2H-pyrrolo[3,2-c]pyridin-2-one is a chemical compound characterized by its complex bicyclic structure, which includes a pyrrolopyridinone framework. This compound features a methoxy group and a phenylmethyl substituent, contributing to its unique chemical properties. It is typically classified as a heterocyclic organic compound due to the presence of nitrogen atoms in its ring structure. The methoxy group can influence its solubility and reactivity, while the phenylmethyl group may enhance its lipophilicity, potentially affecting its biological activity. The compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its specific interactions and applications would depend on further studies, including its synthesis, stability, and potential therapeutic effects. As with many organic compounds, understanding its characteristics requires consideration of its molecular interactions, reactivity, and the influence of substituents on its overall behavior in different environments.
Formula:C15H14N2O2
InChI:InChI=1S/C15H14N2O2/c1-19-15-12-9-14(18)17(13(12)7-8-16-15)10-11-5-3-2-4-6-11/h2-8H,9-10H2,1H3
InChI key:InChIKey=ZZBHUAUQQVOABZ-UHFFFAOYSA-N
SMILES:C(N1C=2C(=C(OC)N=CC2)CC1=O)C3=CC=CC=C3
Synonyms:
  • 2H-Pyrrolo[3,2-c]pyridin-2-one, 1,3-dihydro-4-methoxy-1-(phenylmethyl)-
  • 1,3-Dihydro-4-methoxy-1-(phenylmethyl)-2H-pyrrolo[3,2-c]pyridin-2-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.