CAS 1082041-30-2

3-Chloro-6-iodo-1H-indazol-4-amine

Description:

3-Chloro-6-iodo-1H-indazol-4-amine is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of chlorine and iodine substituents at the 3 and 6 positions, respectively, contributes to its unique reactivity and potential biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and may have limited solubility in water, which is common for halogenated compounds. The amine functional group at the 4-position can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a valuable intermediate in organic synthesis. Additionally, compounds with similar structures have been studied for their potential pharmacological activities, including anti-cancer and anti-inflammatory properties. As with many halogenated compounds, safety precautions should be taken due to potential toxicity and environmental impact. Overall, 3-Chloro-6-iodo-1H-indazol-4-amine is of interest in both synthetic chemistry and medicinal chemistry research.

Formula: C₇H₅ClIN₃

InChI: InChI=1S/C7H5ClIN3/c8-7-6-4(10)1-3(9)2-5(6)11-12-7/h1-2H,10H2,(H,11,12)

InChI key: InChIKey=KUDBCWSCOZINCQ-UHFFFAOYSA-N

SMILES: NC1=C2C(=CC(I)=C1)NN=C2Cl

Synonyms:

• 1H-Indazol-4-amine, 3-chloro-6-iodo-
• 3-Chloro-6-iodo-1H-indazol-4-amine