
CAS 1082041-41-5
:1,3-Dihydro-4-methoxy-7-methyl-2H-indol-2-one
Description:
1,3-Dihydro-4-methoxy-7-methyl-2H-indol-2-one, identified by its CAS number 1082041-41-5, is a chemical compound belonging to the indole family, which is characterized by a bicyclic structure containing a six-membered benzene ring fused to a five-membered nitrogen-containing pyrrole ring. This compound features a methoxy group (-OCH3) and a methyl group (-CH3) at specific positions on the indole structure, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the methoxy group can influence its reactivity and potential interactions with biological systems, making it of interest in medicinal chemistry and pharmacology. Additionally, compounds of this type may exhibit various biological activities, including anti-inflammatory or anticancer properties, although specific biological data would depend on empirical studies. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C10H11NO2
InChI:InChI=1S/C10H11NO2/c1-6-3-4-8(13-2)7-5-9(12)11-10(6)7/h3-4H,5H2,1-2H3,(H,11,12)
InChI key:InChIKey=BGNBOKYTCPPVNC-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(NC(=O)C2)=C(C)C=C1
Synonyms:- 2H-Indol-2-one, 1,3-dihydro-4-methoxy-7-methyl-
- 1,3-Dihydro-4-methoxy-7-methyl-2H-indol-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.