CymitQuimica logo

CAS 1082041-59-5

:

5-Iodo-6-methoxy-1H-indazole

Description:
5-Iodo-6-methoxy-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of an iodine atom at the 5-position and a methoxy group at the 6-position contributes to its unique chemical properties. This compound is typically classified as a heterocyclic aromatic compound due to the presence of nitrogen atoms in its structure. It may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and drug development. The iodine substituent can enhance the compound's lipophilicity and potentially influence its reactivity and interaction with biological targets. Additionally, the methoxy group can affect the compound's solubility and stability. Overall, 5-Iodo-6-methoxy-1H-indazole represents a versatile scaffold for further chemical modifications and investigations into its pharmacological potential.
Formula:C8H7IN2O
InChI:InChI=1S/C8H7IN2O/c1-12-8-3-7-5(2-6(8)9)4-10-11-7/h2-4H,1H3,(H,10,11)
InChI key:InChIKey=UCPXOCULLMUBQN-UHFFFAOYSA-N
SMILES:O(C)C=1C=C2C(=CC1I)C=NN2
Synonyms:
  • 1H-Indazole, 5-iodo-6-methoxy-
  • 5-Iodo-6-methoxy-1H-indazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.