CAS 1082041-63-1
:Methyl 3-amino-2-methyl-6-nitrobenzoate
Description:
Methyl 3-amino-2-methyl-6-nitrobenzoate, identified by its CAS number 1082041-63-1, is an organic compound that belongs to the class of benzoates. This substance features a benzoate structure with a methyl ester functional group, which contributes to its solubility in organic solvents. The presence of an amino group and a nitro group on the aromatic ring indicates that it may exhibit interesting reactivity and potential biological activity. The amino group can participate in hydrogen bonding and nucleophilic reactions, while the nitro group can influence the compound's electronic properties and reactivity. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development or as an intermediate in organic synthesis. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the overall structure. Safety data and handling precautions should be consulted when working with this compound, as with any chemical substance.
Formula:C9H10N2O4
InChI:InChI=1S/C9H10N2O4/c1-5-6(10)3-4-7(11(13)14)8(5)9(12)15-2/h3-4H,10H2,1-2H3
InChI key:InChIKey=ZXSWYCWUZOVBAQ-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(N(=O)=O)C=CC(N)=C1C
Synonyms:- Methyl 3-amino-2-methyl-6-nitrobenzoate
- Benzoic acid, 3-amino-2-methyl-6-nitro-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.