CAS 1082041-65-3

Methyl 5-nitro-1H-indazole-4-carboxylate

Description:

Methyl 5-nitro-1H-indazole-4-carboxylate is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a nitro group at the 5-position and a carboxylate ester at the 4-position contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound is typically a yellow to orange solid, and its molecular structure suggests it may exhibit interesting biological activities, possibly as a precursor for the development of pharmaceuticals. The methyl ester functional group enhances its solubility in organic solvents, making it suitable for various chemical reactions. Additionally, the nitro group can participate in reduction reactions, allowing for further functionalization. As with many nitro compounds, it may exhibit sensitivity to heat and shock, necessitating careful handling. Overall, Methyl 5-nitro-1H-indazole-4-carboxylate is a versatile compound with potential utility in research and development within the field of chemistry.

Formula: C₉H₇N₃O₄

InChI: InChI=1S/C9H7N3O4/c1-16-9(13)8-5-4-10-11-6(5)2-3-7(8)12(14)15/h2-4H,1H3,(H,10,11)

InChI key: InChIKey=RZLUWMNBRGUNLT-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C2C(=CC=C1N(=O)=O)NN=C2

Synonyms:

• 1H-Indazole-4-carboxylic acid, 5-nitro-, methyl ester
• Methyl 5-nitro-1H-indazole-4-carboxylate