CAS 1082041-66-4
:N-(4-Chloro-1H-indol-6-yl)acetamide
Description:
N-(4-Chloro-1H-indol-6-yl)acetamide is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a chloro substituent at the 4-position of the indole ring contributes to its unique reactivity and potential biological activity. The acetamide functional group attached to the nitrogen atom of the indole enhances its solubility and may influence its interaction with biological targets. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as indole derivatives are known to exhibit a range of pharmacological activities. Its molecular structure suggests that it may participate in hydrogen bonding and other intermolecular interactions, which are crucial for its biological efficacy. Additionally, the compound's stability, solubility, and reactivity can be influenced by the presence of the chloro group, making it a subject of study in various chemical and biological contexts.
Formula:C10H9ClN2O
InChI:InChI=1S/C10H9ClN2O/c1-6(14)13-7-4-9(11)8-2-3-12-10(8)5-7/h2-5,12H,1H3,(H,13,14)
InChI key:InChIKey=WQCUJJWURQFIIA-UHFFFAOYSA-N
SMILES:ClC1=C2C(=CC(NC(C)=O)=C1)NC=C2
Synonyms:- Acetamide, N-(4-chloro-1H-indol-6-yl)-
- N-(4-Chloro-1H-indol-6-yl)acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.