CymitQuimica logo

CAS 1082041-87-9

:

4-fluoro-5-iodo-1H-indazole

Description:
4-Fluoro-5-iodo-1H-indazole is a heterocyclic organic compound characterized by the presence of both fluorine and iodine substituents on the indazole ring system. This compound features a five-membered ring containing two nitrogen atoms, which contributes to its aromaticity and potential reactivity. The fluorine atom typically enhances the compound's lipophilicity and may influence its biological activity, while the iodine atom can provide opportunities for further chemical modifications or applications in medicinal chemistry. The indazole framework is known for its presence in various bioactive molecules, making derivatives like 4-fluoro-5-iodo-1H-indazole of interest in pharmaceutical research. The compound's unique combination of halogen substituents may also affect its electronic properties, stability, and interactions with biological targets. As with many halogenated compounds, considerations regarding its environmental impact and toxicity are important in its application and handling. Overall, 4-fluoro-5-iodo-1H-indazole represents a valuable structure for further exploration in chemical synthesis and drug development.
Formula:C7H4FIN2
InChI:InChI=1S/C7H4FIN2/c8-7-4-3-10-11-6(4)2-1-5(7)9/h1-3H,(H,10,11)
InChI key:ZYMYYSVDKAMZHI-UHFFFAOYSA-N
SMILES:C1=CC(=C(C2=C1NN=C2)F)I
Synonyms:
  • 4-Fluoro-5-iodo-1H-indazole
  • 1H-Indazole, 4-fluoro-5-iodo-
Found 4 products.